CAS 898777-28-1
:Methanone, [4-(1-azetidinylmethyl)phenyl](3-methylphenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](3-methylphenyl)-, identified by its CAS number 898777-28-1, is an organic compound characterized by its unique structure that includes a methanone functional group and a phenyl ring substituted with an azetidine moiety. This compound typically exhibits properties associated with both ketones and aromatic compounds, such as potential reactivity in electrophilic aromatic substitution reactions. The presence of the azetidine ring suggests it may have interesting biological activity, as azetidines are often found in various pharmaceuticals. The compound's molecular structure contributes to its physical properties, including solubility and boiling point, which are influenced by the presence of the aromatic groups and the azetidine ring. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and reactivity would be necessary to fully understand its potential applications and safety profile.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c1-14-4-2-5-17(12-14)18(20)16-8-6-15(7-9-16)13-19-10-3-11-19/h2,4-9,12H,3,10-11,13H2,1H3
InChI key:InChIKey=KNVHGTLNEIQHCF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC=C1)C2=CC=C(CN3CCC3)C=C2
Synonyms:- Methanone, [4-(1-azetidinylmethyl)phenyl](3-methylphenyl)-
- [4-(1-Azetidinylmethyl)phenyl](3-methylphenyl)methanone
- 4'-AZETIDINOMETHYL-3-METHYLBENZOPHENONE
- (4-(Azetidin-1-ylmethyl)phenyl)(m-tolyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.