CAS 898777-30-5
:ethyl 6-(3-iodophenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(3-iodophenyl)-6-oxo-hexanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a hexanoate backbone, indicating a six-carbon chain, with a ketone group (6-oxo) and a phenyl ring substituted with an iodine atom at the para position (3-iodophenyl). The presence of the iodine atom introduces unique properties, such as increased molecular weight and potential for reactivity in nucleophilic substitution reactions. Ethyl 6-(3-iodophenyl)-6-oxo-hexanoate may exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic alkyl chain and polar functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the synthesis of biologically active compounds. Additionally, the compound's stability and reactivity can be influenced by the presence of the iodine substituent, which may affect its behavior in various chemical reactions.
Formula:C14H17IO3
InChI:InChI=1/C14H17IO3/c1-2-18-14(17)9-4-3-8-13(16)11-6-5-7-12(15)10-11/h5-7,10H,2-4,8-9H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1cccc(c1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.