CAS 898777-31-6
:Methanone, [4-(1-azetidinylmethyl)phenyl](4-methylphenyl)-
Description:
Methanone, [4-(1-azetidinylmethyl)phenyl](4-methylphenyl)-, also known by its CAS number 898777-31-6, is an organic compound characterized by its unique structure that includes a methanone functional group and an azetidine ring. This compound features a phenyl group substituted with a 4-methylphenyl moiety and a 4-(1-azetidinylmethyl)phenyl group, which contributes to its potential biological activity. The presence of the azetidine ring suggests that it may exhibit interesting pharmacological properties, as azetidines are often found in various bioactive compounds. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. Its synthesis may involve multi-step organic reactions, and it could be of interest in medicinal chemistry for its potential applications in drug development. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C18H19NO
InChI:InChI=1/C18H19NO/c1-14-3-7-16(8-4-14)18(20)17-9-5-15(6-10-17)13-19-11-2-12-19/h3-10H,2,11-13H2,1H3
InChI key:InChIKey=BTWWNIWSISRMLK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CN2CCC2)C=C1)C3=CC=C(C)C=C3
Synonyms:- [4-(1-Azetidinylmethyl)phenyl](4-methylphenyl)methanone
- Methanone, [4-(1-azetidinylmethyl)phenyl](4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.