CAS 898777-33-8
:ethyl 7-(3-iodophenyl)-7-oxo-heptanoate
Description:
Ethyl 7-(3-iodophenyl)-7-oxo-heptanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a heptanoate backbone, indicating it has a seven-carbon chain, with a ketone group at the seventh position and a phenyl ring substituted with an iodine atom at the meta position (3-iodophenyl). The presence of the iodine atom introduces unique properties, such as increased molecular weight and potential for reactivity in various chemical reactions, including electrophilic substitutions. The ethyl group contributes to its solubility in organic solvents and may influence its biological activity. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific pharmacological properties or facilitate interactions in biological systems. Its CAS number, 898777-33-8, allows for easy identification and reference in chemical databases and literature.
Formula:C15H19IO3
InChI:InChI=1/C15H19IO3/c1-2-19-15(18)10-5-3-4-9-14(17)12-7-6-8-13(16)11-12/h6-8,11H,2-5,9-10H2,1H3
SMILES:CCOC(=O)CCCCCC(=O)c1cccc(c1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.