CAS 898777-39-4
:ethyl 4-(4-iodophenyl)-4-oxo-butanoate
Description:
Ethyl 4-(4-iodophenyl)-4-oxo-butanoate, with the CAS number 898777-39-4, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a butanoate backbone, where the ethyl group is attached to the carboxylic acid part, and a phenyl ring substituted with an iodine atom at the para position. The presence of the iodine atom enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The ketone functional group contributes to its potential as a precursor in synthetic organic chemistry. Ethyl 4-(4-iodophenyl)-4-oxo-butanoate may exhibit biological activity, which can be explored in medicinal chemistry contexts. Its solubility and stability in organic solvents make it suitable for various applications in research and industry. As with many organic compounds, handling should be done with care, considering safety protocols due to potential toxicity associated with iodine-containing compounds.
Formula:C12H13IO3
InChI:InChI=1/C12H13IO3/c1-2-16-12(15)8-7-11(14)9-3-5-10(13)6-4-9/h3-6H,2,7-8H2,1H3
SMILES:CCOC(=O)CCC(=O)c1ccc(cc1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.