CAS 898777-42-9
:Ethyl 4-iodo-δ-oxobenzenepentanoate
Description:
Ethyl 4-iodo-δ-oxobenzenepentanoate is an organic compound characterized by its complex structure, which includes an ethyl ester group, a 4-iodo substituent on a benzene ring, and a δ-oxobutanoate moiety. This compound typically exhibits a moderate to high molecular weight due to the presence of multiple functional groups. The iodo substituent enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The ester functional group contributes to its solubility in organic solvents, while the presence of the carbonyl group (from the δ-oxobutanoate) can participate in further chemical transformations, such as condensation reactions. Ethyl 4-iodo-δ-oxobenzenepentanoate may also display interesting biological activities, making it a potential candidate for pharmaceutical applications. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C13H15IO3
InChI:InChI=1S/C13H15IO3/c1-2-17-13(16)5-3-4-12(15)10-6-8-11(14)9-7-10/h6-9H,2-5H2,1H3
InChI key:InChIKey=FVVNEZTUGRPDNG-UHFFFAOYSA-N
SMILES:C(CCCC(OCC)=O)(=O)C1=CC=C(I)C=C1
Synonyms:- Benzenepentanoic acid, 4-iodo-δ-oxo-, ethyl ester
- Ethyl 4-iodo-δ-oxobenzenepentanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.