CAS 898777-43-0

2-[4-(1-Azetidinylmethyl)benzoyl]benzonitrile

Description:

2-[4-(1-Azetidinylmethyl)benzoyl]benzonitrile, with the CAS number 898777-43-0, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a benzonitrile moiety. The presence of the azetidine ring contributes to its unique properties, potentially influencing its reactivity and biological activity. This compound may exhibit specific interactions due to the functional groups present, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as pharmacology, where it could serve as a lead compound for further modifications. The compound's solubility, stability, and reactivity would depend on the specific conditions, including solvent and temperature. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, 2-[4-(1-Azetidinylmethyl)benzoyl]benzonitrile represents a class of compounds that may have significant implications in research and development within the chemical and pharmaceutical industries.

Formula: C₁₈H₁₆N₂O

InChI: InChI=1S/C18H16N2O/c19-12-16-4-1-2-5-17(16)18(21)15-8-6-14(7-9-15)13-20-10-3-11-20/h1-2,4-9H,3,10-11,13H2

InChI key: InChIKey=QUBHTRGESNNQRC-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C#N)C=CC=C1)C2=CC=C(CN3CCC3)C=C2

Synonyms:

• Benzonitrile, 2-[4-(1-azetidinylmethyl)benzoyl]-
• 2-[4-(1-Azetidinylmethyl)benzoyl]benzonitrile