CAS 898777-52-1

1-(2,6-dichlorophenyl)-3-(3,4-difluorophenyl)propan-1-one

Description:

1-(2,6-Dichlorophenyl)-3-(3,4-difluorophenyl)propan-1-one, with the CAS number 898777-52-1, is an organic compound characterized by its complex structure featuring a propanone backbone substituted with two distinct aromatic rings. The presence of the 2,6-dichlorophenyl group introduces significant electron-withdrawing effects due to the chlorine atoms, which can influence the compound's reactivity and stability. The 3,4-difluorophenyl group adds further electron-withdrawing characteristics, enhancing the compound's potential for various chemical interactions. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its unique substitution pattern may also impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of halogen atoms can affect the compound's solubility, melting point, and boiling point, which are important for its practical applications. Overall, this compound's structural features suggest it may have significant utility in synthetic organic chemistry and medicinal chemistry.

Formula: C₁₅H₁₀Cl₂F₂O

InChI: InChI=1/C15H10Cl2F2O/c16-10-2-1-3-11(17)15(10)14(20)7-5-9-4-6-12(18)13(19)8-9/h1-4,6,8H,5,7H2

InChI key: InChIKey=RFKRWTUPQAMVOP-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=C(F)C=C1)(=O)C2=C(Cl)C=CC=C2Cl

Synonyms:

• 2′,6′-Dichloro-3-(3,4-difluorophenyl)propiophenone
• 1-Propanone, 1-(2,6-dichlorophenyl)-3-(3,4-difluorophenyl)-
• 1-(2,6-Dichlorophenyl)-3-(3,4-difluorophenyl)-1-propanone