CAS 898777-54-3
:1-(2,6-dichlorophenyl)-3-(3,5-difluorophenyl)propan-1-one
Description:
1-(2,6-Dichlorophenyl)-3-(3,5-difluorophenyl)propan-1-one, with the CAS number 898777-54-3, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features two aromatic rings: one with two chlorine substituents at the 2 and 6 positions and another with two fluorine substituents at the 3 and 5 positions. These halogen substituents significantly influence the compound's chemical properties, including its reactivity, polarity, and potential biological activity. The presence of the dichlorophenyl and difluorophenyl groups suggests that this compound may exhibit interesting electronic properties and could be of interest in medicinal chemistry or materials science. Additionally, the molecular structure indicates potential for various interactions, such as hydrogen bonding or π-π stacking, which could affect its solubility and stability in different solvents. Overall, this compound's unique structural features make it a candidate for further research in various chemical applications.
Formula:C15H10Cl2F2O
InChI:InChI=1/C15H10Cl2F2O/c16-12-2-1-3-13(17)15(12)14(20)5-4-9-6-10(18)8-11(19)7-9/h1-3,6-8H,4-5H2
SMILES:c1cc(c(c(c1)Cl)C(=O)CCc1cc(cc(c1)F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.