CymitQuimica logo

CAS 898777-62-3

:

1-(p-tolyl)-3-(3,4,5-trifluorophenyl)propan-1-one

Description:
1-(p-Tolyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898777-62-3, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a p-tolyl group (a para-methylphenyl group) and a trifluorophenyl group, which significantly influences its chemical properties. The presence of the trifluoromethyl groups enhances the compound's lipophilicity and can affect its reactivity and interaction with biological systems. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its hydrophobic characteristics. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. Additionally, the trifluoromethyl group is known to impart unique electronic properties, making this compound of interest in materials science and medicinal chemistry. Safety data and handling precautions should be considered, as with all chemical substances, particularly those with halogenated groups.
Formula:C16H13F3O
InChI:InChI=1/C16H13F3O/c1-10-2-5-12(6-3-10)15(20)7-4-11-8-13(17)16(19)14(18)9-11/h2-3,5-6,8-9H,4,7H2,1H3
SMILES:Cc1ccc(cc1)C(=O)CCc1cc(c(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.