CAS 898777-64-5

1-Propanone, 1-(2-methoxyphenyl)-3-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 1-(2-methoxyphenyl)-3-(3,4,5-trifluorophenyl)-, also known by its CAS number 898777-64-5, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a methoxyphenyl group and a trifluorophenyl group. The presence of the methoxy group enhances its solubility in organic solvents and can influence its reactivity and interaction with biological systems. The trifluorophenyl group introduces significant electronegativity, which can affect the compound's electronic properties and stability. Typically, compounds of this nature may exhibit interesting chemical behavior, including potential applications in pharmaceuticals or as intermediates in organic synthesis. The molecular structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the conditions. Additionally, the presence of fluorine atoms can enhance lipophilicity and alter the compound's pharmacokinetic properties, making it a subject of interest in medicinal chemistry.

Formula: C₁₆H₁₃F₃O₂

InChI: InChI=1S/C16H13F3O2/c1-21-15-5-3-2-4-11(15)14(20)7-6-10-8-12(17)16(19)13(18)9-10/h2-5,8-9H,6-7H2,1H3

InChI key: InChIKey=YZMNBOPGYMMRED-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=C(F)C(F)=C1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• 2′-Methoxy-3-(3,4,5-trifluorophenyl)propiophenone
• 1-Propanone, 1-(2-methoxyphenyl)-3-(3,4,5-trifluorophenyl)-
• 1-(2-Methoxyphenyl)-3-(3,4,5-trifluorophenyl)-1-propanone