CAS 898777-68-9
:1-(4-methoxyphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(4-Methoxyphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898777-68-9, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. The structure features a propanone backbone, where one end is substituted with a 4-methoxyphenyl group and the other with a 3,4,5-trifluorophenyl group. This compound exhibits significant lipophilicity due to the presence of fluorine atoms, which can enhance its biological activity and stability. The methoxy group contributes to its electronic properties, potentially influencing reactivity and solubility. Additionally, the trifluoromethyl groups are known to impart unique characteristics, such as increased metabolic stability and altered pharmacokinetics. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its synthesis and reactivity can be influenced by the electronic effects of the substituents, making it a subject of study in various chemical research fields.
Formula:C16H13F3O2
InChI:InChI=1/C16H13F3O2/c1-21-12-5-3-11(4-6-12)15(20)7-2-10-8-13(17)16(19)14(18)9-10/h3-6,8-9H,2,7H2,1H3
SMILES:COc1ccc(cc1)C(=O)CCc1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.