CymitQuimica logo

CAS 898777-79-2

:

ethyl 8-oxo-8-[3-(trifluoromethyl)phenyl]octanoate

Description:
Ethyl 8-oxo-8-[3-(trifluoromethyl)phenyl]octanoate, identified by its CAS number 898777-79-2, is an organic compound characterized by its ester functional group and a complex structure that includes a trifluoromethyl-substituted phenyl ring. This compound features an octanoate chain, which contributes to its hydrophobic properties, while the presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The ketone functional group (8-oxo) indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Ethyl 8-oxo-8-[3-(trifluoromethyl)phenyl]octanoate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, where the trifluoromethyl group is often associated with increased potency and metabolic stability. As with many organic compounds, its reactivity and stability will depend on environmental conditions and the presence of other reactive species.
Formula:C17H21F3O3
InChI:InChI=1/C17H21F3O3/c1-2-23-16(22)11-6-4-3-5-10-15(21)13-8-7-9-14(12-13)17(18,19)20/h7-9,12H,2-6,10-11H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cccc(c1)C(F)(F)F
Synonyms:
  • Benzeneoctanoic acid, η-oxo-3-(trifluoromethyl)-, ethyl ester
  • ETHYL 8-OXO-8-(3-TRIFLUOROMETHYLPHENYL)OCTANOATE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.