CAS 898777-82-7
:1-(2-methylsulfanylphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(2-Methylsulfanylphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898777-82-7, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a methylsulfanyl group and a trifluorophenyl group. The presence of the methylsulfanyl group contributes to its potential reactivity and solubility properties, while the trifluorophenyl group enhances its electronic characteristics, possibly affecting its interactions in biological systems or chemical reactions. This compound may exhibit unique physical properties such as specific melting and boiling points, solubility in various solvents, and potential applications in pharmaceuticals or agrochemicals due to its structural features. Additionally, the trifluoromethyl groups are known to impart significant lipophilicity, which can influence the compound's bioavailability and pharmacokinetics. Overall, the combination of these functional groups suggests that this compound could be of interest in medicinal chemistry and material science, warranting further investigation into its properties and potential applications.
Formula:C16H13F3OS
InChI:InChI=1/C16H13F3OS/c1-21-15-5-3-2-4-11(15)14(20)7-6-10-8-12(17)16(19)13(18)9-10/h2-5,8-9H,6-7H2,1H3
SMILES:CSc1ccccc1C(=O)CCc1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.