CAS 898777-88-3

1-Propanone, 1-(4-bromophenyl)-3-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 1-(4-bromophenyl)-3-(3,4,5-trifluorophenyl)-, with CAS number 898777-88-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with a bromophenyl group at one end and a trifluorophenyl group at the other, contributing to its unique chemical properties. The presence of the bromine atom and multiple fluorine atoms enhances its reactivity and polarity, potentially influencing its solubility in various solvents. The trifluoromethyl groups are known to impart significant electronic effects, which can affect the compound's stability and reactivity in chemical reactions. Additionally, the compound may exhibit interesting biological activities due to its structural characteristics, making it a subject of interest in medicinal chemistry and material science. Its synthesis and applications could be explored in various fields, including pharmaceuticals and agrochemicals, where such substituted ketones may serve as intermediates or active ingredients.

Formula: C₁₅H₁₀BrF₃O

InChI: InChI=1S/C15H10BrF3O/c16-11-4-2-10(3-5-11)14(20)6-1-9-7-12(17)15(19)13(18)8-9/h2-5,7-8H,1,6H2

InChI key: InChIKey=HQXSLRAAZKFKKG-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=C(F)C(F)=C1)(=O)C2=CC=C(Br)C=C2

Synonyms:

• 1-Propanone, 1-(4-bromophenyl)-3-(3,4,5-trifluorophenyl)-
• 1-(4-Bromophenyl)-3-(3,4,5-trifluorophenyl)-1-propanone