CAS 898777-90-7

1-Propanone, 1-(3-chlorophenyl)-3-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 1-(3-chlorophenyl)-3-(3,4,5-trifluorophenyl)-, also known by its CAS number 898777-90-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 3,4,5-trifluorophenyl group. The presence of the chlorine and trifluoromethyl groups introduces significant electronegative characteristics, influencing the compound's reactivity and polarity. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The trifluoromethyl groups can enhance biological activity and stability, making this compound of interest in pharmaceutical and agrochemical research. Additionally, the presence of halogens often contributes to unique electronic properties, which can be exploited in various chemical reactions. Overall, this compound's structure suggests potential applications in synthetic chemistry and material science, although specific applications would depend on further research and development.

Formula: C₁₅H₁₀ClF₃O

InChI: InChI=1S/C15H10ClF3O/c16-11-3-1-2-10(8-11)14(20)5-4-9-6-12(17)15(19)13(18)7-9/h1-3,6-8H,4-5H2

InChI key: InChIKey=JWXYXQSUNHLGLD-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=CC(Cl)=CC=C1)C2=CC(F)=C(F)C(F)=C2

Synonyms:

• 1-(3-Chlorophenyl)-3-(3,4,5-trifluorophenyl)-1-propanone
• 3′-Chloro-3-(3,4,5-trifluorophenyl)propiophenone
• 1-Propanone, 1-(3-chlorophenyl)-3-(3,4,5-trifluorophenyl)-