CAS 898777-91-8

ethyl 7-(2,3-dichlorophenyl)-7-oxo-heptanoate

Description:

Ethyl 7-(2,3-dichlorophenyl)-7-oxo-heptanoate, with the CAS number 898777-91-8, is an organic compound characterized by its ester functional group, which is typical of ethyl esters. This compound features a heptanoate backbone, indicating it is derived from heptanoic acid, and includes a ketone group (7-oxo) at the seventh carbon position. The presence of a 2,3-dichlorophenyl substituent suggests that it has significant aromatic character, which can influence its reactivity and interactions. The dichlorination of the phenyl ring may enhance its biological activity and lipophilicity, making it potentially useful in pharmaceutical applications. Ethyl esters are generally known for their pleasant odors and are often used in flavoring and fragrance industries. The specific structural features of this compound may also confer unique properties, such as solubility in organic solvents and potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. Overall, this compound's characteristics make it a subject of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₅H₁₈Cl₂O₃

InChI: InChI=1/C15H18Cl2O3/c1-2-20-14(19)10-5-3-4-9-13(18)11-7-6-8-12(16)15(11)17/h6-8H,2-5,9-10H2,1H3

SMILES: CCOC(=O)CCCCCC(=O)c1cccc(c1Cl)Cl