CAS 898777-92-9

1-(4-chlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one

Description:

1-(4-chlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898777-92-9, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. This compound features a propanone backbone, where one end is substituted with a 4-chlorophenyl group and the other with a 3,4,5-trifluorophenyl group. The presence of chlorine and trifluoromethyl groups contributes to its unique electronic properties, potentially enhancing its reactivity and lipophilicity. The trifluoromethyl groups are known to impart significant influence on the compound's biological activity and stability. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including agrochemicals and materials science. However, specific safety and handling guidelines should be followed due to the presence of halogenated substituents, which can pose environmental and health risks.

Formula: C₁₅H₁₀ClF₃O

InChI: InChI=1/C15H10ClF3O/c16-11-4-2-10(3-5-11)14(20)6-1-9-7-12(17)15(19)13(18)8-9/h2-5,7-8H,1,6H2

SMILES: C(CC(=O)c1ccc(cc1)Cl)c1cc(c(c(c1)F)F)F