CAS 898777-93-0

Ethyl 2,3-dichloro-η-oxobenzeneoctanoate

Description:

Ethyl 2,3-dichloro-η-oxobenzeneoctanoate, identified by its CAS number 898777-93-0, is a chemical compound that features a complex structure combining an ethyl ester with dichlorobenzene and an octanoate moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a distinctive odor. The presence of chlorine atoms in its structure may impart unique reactivity and stability properties, influencing its behavior in various chemical reactions. The oxobenzene component suggests potential aromatic characteristics, which can affect solubility and interaction with other substances. Ethyl 2,3-dichloro-η-oxobenzeneoctanoate may be utilized in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. Its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies, as the presence of chlorine can raise concerns regarding bioaccumulation and persistence in the environment. Overall, this compound represents a specialized chemical with potential applications in various fields of chemistry.

Formula: C₁₆H₂₀Cl₂O₃

InChI: InChI=1S/C16H20Cl2O3/c1-2-21-15(20)11-6-4-3-5-10-14(19)12-8-7-9-13(17)16(12)18/h7-9H,2-6,10-11H2,1H3

InChI key: InChIKey=GANNSLPPFDIBRT-UHFFFAOYSA-N

SMILES: C(CCCCCCC(OCC)=O)(=O)C1=C(Cl)C(Cl)=CC=C1

Synonyms:

• Benzeneoctanoic acid, 2,3-dichloro-η-oxo-, ethyl ester
• Ethyl 2,3-dichloro-η-oxobenzeneoctanoate