CAS 898777-94-1
:1-Propanone, 1-(3-fluorophenyl)-3-(3,4,5-trifluorophenyl)-
Description:
1-Propanone, 1-(3-fluorophenyl)-3-(3,4,5-trifluorophenyl)-, also known by its CAS number 898777-94-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-fluorophenyl group and a 3,4,5-trifluorophenyl group. The presence of multiple fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The fluorine substituents can enhance the compound's stability and influence its reactivity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's molecular structure suggests potential applications in drug development or as a building block in organic synthesis. Its physical properties, such as boiling point, melting point, and solubility, would typically be influenced by the presence of the fluorinated aromatic rings, which can affect intermolecular interactions. Overall, this compound exemplifies the complexity and versatility of fluorinated organic molecules.
Formula:C15H10F4O
InChI:InChI=1S/C15H10F4O/c16-11-3-1-2-10(8-11)14(20)5-4-9-6-12(17)15(19)13(18)7-9/h1-3,6-8H,4-5H2
InChI key:InChIKey=KLBQBXGRTWHYOW-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(F)=CC=C1)C2=CC(F)=C(F)C(F)=C2
Synonyms:- 3′-Fluoro-3-(3,4,5-trifluorophenyl)propiophenone
- 1-Propanone, 1-(3-fluorophenyl)-3-(3,4,5-trifluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.