CAS 898777-99-6
:ethyl 6-(2,4-dichlorophenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(2,4-dichlorophenyl)-6-oxo-hexanoate is an organic compound characterized by its ester functional group, which is derived from hexanoic acid and ethyl alcohol. The presence of a 2,4-dichlorophenyl group indicates that the compound has significant aromatic characteristics, contributing to its chemical stability and potential reactivity. The oxo group (carbonyl) at the 6-position enhances the compound's electrophilic nature, making it a potential candidate for various chemical reactions, including nucleophilic additions. This compound may exhibit moderate to high lipophilicity due to its long carbon chain and aromatic structure, influencing its solubility in organic solvents. Additionally, the dichlorophenyl substituent can impart unique biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C14H16Cl2O3
InChI:InChI=1/C14H16Cl2O3/c1-2-19-14(18)6-4-3-5-13(17)11-8-7-10(15)9-12(11)16/h7-9H,2-6H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.