CAS 898778-00-2
:1-(2,4-dimethylphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(2,4-Dimethylphenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, identified by its CAS number 898778-00-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,4-dimethylphenyl group and a 3,4,5-trifluorophenyl group. The presence of multiple methyl groups and trifluoromethyl groups contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The trifluoromethyl group is known to enhance the metabolic stability of compounds, while the dimethylphenyl moiety may influence its electronic properties. This compound may exhibit interesting reactivity patterns typical of ketones, such as nucleophilic addition and condensation reactions. Its structural complexity suggests potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C17H15F3O
InChI:InChI=1/C17H15F3O/c1-10-3-5-13(11(2)7-10)16(21)6-4-12-8-14(18)17(20)15(19)9-12/h3,5,7-9H,4,6H2,1-2H3
SMILES:Cc1ccc(c(C)c1)C(=O)CCc1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.