CAS 898778-01-3

(2-Bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

The chemical substance known as (2-Bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-01-3, is a complex organic compound featuring a bromophenyl group and a thienyl moiety linked through a methanone functional group. This compound contains a dioxolane ring, which contributes to its structural diversity and potential reactivity. The presence of the bromine atom enhances its electrophilic character, making it suitable for various chemical reactions, including nucleophilic substitutions. The thienyl group, derived from thiophene, imparts aromatic characteristics and may influence the compound's electronic properties. This substance may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure suggests potential applications in organic synthesis and material science. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Proper handling and safety measures should be observed due to the presence of bromine and other reactive components.

Formula: C₁₄H₁₁BrO₃S

InChI: InChI=1S/C14H11BrO3S/c15-10-4-2-1-3-9(10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-6,14H,7-8H2

InChI key: InChIKey=IMOGHCPWMPDCLQ-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=C(Br)C=CC=C3

Synonyms:

• Methanone, (2-bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-
• (2-Bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone