CAS 898778-04-6

(3-bromophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

The chemical substance known as (3-bromophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-04-6, is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The bromine atom in the phenyl ring can influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The dioxolane ring contributes to the compound's solubility and may enhance its biological activity. Additionally, the thienyl group can impart unique electronic characteristics, potentially making this compound of interest in medicinal chemistry and materials science. Overall, the combination of these structural features suggests that this compound may have applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₁₄H₁₁BrO₃S

InChI: InChI=1/C14H11BrO3S/c15-10-3-1-2-9(8-10)13(16)11-4-5-12(19-11)14-17-6-7-18-14/h1-5,8,14H,6-7H2

SMILES: c1cc(cc(c1)Br)C(=O)c1ccc(C2OCCO2)s1