CAS 898778-07-9

(4-bromophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

(4-bromophenyl)-[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone is a synthetic organic compound characterized by its complex structure, which includes a bromophenyl group, a dioxolane ring, and a thienyl moiety. The presence of the bromine atom introduces notable electrophilic properties, enhancing its reactivity in various chemical reactions. The dioxolane ring contributes to the compound's stability and solubility in polar solvents, while the thienyl group adds to its aromatic character and potential for π-π stacking interactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its unique structural features suggest potential applications in organic synthesis and materials science. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as the presence of bromine can pose health risks.

Formula: C₁₄H₁₁BrO₃S

InChI: InChI=1/C14H11BrO3S/c15-10-3-1-9(2-4-10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-6,14H,7-8H2

InChI key: InChIKey=FAHWAHPJWNYUCW-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(Br)C=C3

Synonyms:

• (4-Bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
• Methanone, (4-bromophenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-