CymitQuimica logo

CAS 898778-08-0

:

ethyl 4-(2,5-dichlorophenyl)-4-oxo-butanoate

Description:
Ethyl 4-(2,5-dichlorophenyl)-4-oxo-butanoate is an organic compound characterized by its ester functional group, which is typical of ethyl esters. The presence of a 2,5-dichlorophenyl group indicates that the compound has significant aromatic characteristics, likely contributing to its chemical stability and potential reactivity. The "4-oxo" designation suggests that there is a ketone functional group within the butanoate structure, which can influence the compound's reactivity and interactions with other molecules. This compound may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical or agrochemical research. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or condensation reactions, depending on the conditions. Additionally, the presence of chlorine atoms may enhance its lipophilicity and alter its biological activity. Overall, ethyl 4-(2,5-dichlorophenyl)-4-oxo-butanoate is a complex molecule with potential applications in various fields of chemistry and material science.
Formula:C12H12Cl2O3
InChI:InChI=1/C12H12Cl2O3/c1-2-17-12(16)6-5-11(15)9-7-8(13)3-4-10(9)14/h3-4,7H,2,5-6H2,1H3
SMILES:CCOC(=O)CCC(=O)c1cc(ccc1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.