CAS 898778-10-4
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-iodophenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(2-iodophenyl)methanone, with the CAS number 898778-10-4, exhibits several notable characteristics. It is a synthetic organic compound that features a complex structure, incorporating a thienyl ring, a dioxolane moiety, and an iodo-substituted phenyl group. This compound is likely to be a solid at room temperature, given its structural complexity and the presence of multiple functional groups. The dioxolane ring contributes to its potential solubility in polar solvents, while the thienyl and iodo-phenyl components may enhance its reactivity and interaction with biological targets. The presence of the carbonyl group in the methanone structure suggests potential for electrophilic reactivity, making it a candidate for various chemical reactions, including nucleophilic attacks. Additionally, the iodine atom may impart unique properties, such as increased lipophilicity and potential for halogen bonding. Overall, this compound may have applications in medicinal chemistry, particularly in the development of novel pharmaceuticals or agrochemicals.
Formula:C14H11IO3S
InChI:InChI=1/C14H11IO3S/c15-10-4-2-1-3-9(10)13(16)11-5-6-12(19-11)14-17-7-8-18-14/h1-6,14H,7-8H2
SMILES:c1ccc(c(c1)C(=O)c1ccc(C2OCCO2)s1)I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.