CAS 898778-13-7
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-iodophenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-iodophenyl)methanone, with the CAS number 898778-13-7, is characterized by its complex molecular structure that includes a thienyl ring, a dioxolane moiety, and an iodo-substituted phenyl group. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxolane ring suggests that it may exhibit properties related to cyclic ethers, such as stability and solubility in various solvents. The thienyl and iodo groups can impart unique electronic properties, making the compound of interest in fields such as medicinal chemistry and materials science. Additionally, the iodine atom may enhance the compound's reactivity in nucleophilic substitution reactions. Overall, this substance's structural features suggest potential utility in the development of pharmaceuticals or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C14H11IO3S
InChI:InChI=1/C14H11IO3S/c15-10-3-1-2-9(8-10)13(16)11-4-5-12(19-11)14-17-6-7-18-14/h1-5,8,14H,6-7H2
SMILES:c1cc(cc(c1)I)C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.