CAS 898778-18-2

1-(4-chloro-3-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-18-2, is an organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a propanone functional group, which is indicative of ketones, and is substituted with a chloro and a fluoro group on one phenyl ring, while the other phenyl ring is heavily substituted with three fluorine atoms. The presence of these electronegative halogens significantly influences the compound's physical and chemical properties, such as increased lipophilicity and potential reactivity. The trifluorophenyl group may enhance the compound's stability and alter its electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's unique structure may contribute to specific biological activities, making it a candidate for further research in drug development or as a synthetic intermediate. Its synthesis and handling require careful consideration due to the presence of halogens, which can pose environmental and health risks.

Formula: C₁₅H₉ClF₄O

InChI: InChI=1/C15H9ClF4O/c16-10-3-2-9(7-11(10)17)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2

SMILES: C(CC(=O)c1ccc(c(c1)F)Cl)c1cc(c(c(c1)F)F)F