CymitQuimica logo

CAS 898778-22-8

:

4-[5-(1,3-dioxolan-2-yl)thiophene-2-carbonyl]benzonitrile

Description:
4-[5-(1,3-Dioxolan-2-yl)thiophene-2-carbonyl]benzonitrile, with the CAS number 898778-22-8, is a synthetic organic compound characterized by its complex structure that includes a thiophene ring, a dioxolane moiety, and a benzonitrile group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for π-π stacking interactions due to its conjugated system. The presence of the dioxolane ring suggests it may participate in reactions typical of ethers, while the thiophene component can contribute to its electronic properties, making it potentially useful in organic electronics or as a building block in organic synthesis. The benzonitrile group adds to its polarity and may influence solubility in various solvents. Overall, this compound's unique structure may confer interesting chemical reactivity and applications in materials science, pharmaceuticals, or agrochemicals, although specific applications would depend on further research and characterization.
Formula:C15H11NO3S
InChI:InChI=1/C15H11NO3S/c16-9-10-1-3-11(4-2-10)14(17)12-5-6-13(20-12)15-18-7-8-19-15/h1-6,15H,7-8H2
SMILES:c1cc(ccc1C#N)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.