CAS 898778-23-9
:ethyl 5-(4-ethylphenyl)-5-oxo-pentanoate
Description:
Ethyl 5-(4-ethylphenyl)-5-oxo-pentanoate, identified by its CAS number 898778-23-9, is an organic compound characterized by its ester functional group and a ketone moiety. This substance features a pentanoate backbone, which is a five-carbon chain with a carbonyl group (C=O) at the fifth position, contributing to its reactivity and potential applications in organic synthesis. The presence of the 4-ethylphenyl group enhances its hydrophobic characteristics, influencing its solubility and interaction with other compounds. Ethyl esters like this one are often used in the synthesis of pharmaceuticals, agrochemicals, and fragrances due to their ability to undergo various chemical reactions, including hydrolysis and transesterification. The compound's molecular structure suggests it may exhibit interesting biological activities, although specific biological properties would require further investigation. Overall, ethyl 5-(4-ethylphenyl)-5-oxo-pentanoate represents a versatile building block in organic chemistry with potential applications in various fields.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-3-12-8-10-13(11-9-12)14(16)6-5-7-15(17)18-4-2/h8-11H,3-7H2,1-2H3
SMILES:CCc1ccc(cc1)C(=O)CCCC(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.