CAS 898778-24-0
:1-(2-chlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(2-Chlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, identified by its CAS number 898778-24-0, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. This compound features a propanone backbone, with a chlorinated phenyl group and a highly fluorinated phenyl group, which contribute to its unique chemical properties. The presence of the chlorine and trifluoromethyl groups enhances its lipophilicity and may influence its reactivity and biological activity. Typically, such compounds exhibit significant stability due to the resonance stabilization provided by the aromatic systems. They may also demonstrate interesting pharmacological properties, making them of interest in medicinal chemistry. The trifluoromethyl groups can impart unique electronic characteristics, potentially affecting the compound's interaction with biological targets. Overall, this compound's structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C15H10ClF3O
InChI:InChI=1/C15H10ClF3O/c16-11-4-2-1-3-10(11)14(20)6-5-9-7-12(17)15(19)13(18)8-9/h1-4,7-8H,5-6H2
SMILES:c1ccc(c(c1)C(=O)CCc1cc(c(c(c1)F)F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.