CymitQuimica logo

CAS 898778-25-1

:

[5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-phenoxyphenyl)methanone

Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(3-phenoxyphenyl)methanone, with the CAS number 898778-25-1, is a synthetic organic compound characterized by its complex molecular structure. It features a thienyl group, which is a five-membered aromatic ring containing sulfur, and a dioxolane moiety, which is a cyclic ether with two oxygen atoms in the ring. The presence of a phenoxyphenyl group indicates that the compound has significant aromatic character, contributing to its potential stability and reactivity. This compound may exhibit interesting biological activities due to its structural components, which can influence interactions with biological targets. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, making it a candidate for various applications in medicinal chemistry or materials science. Its solubility, melting point, and other physical properties would depend on the specific interactions between its functional groups and the surrounding environment. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C20H16O4S
InChI:InChI=1/C20H16O4S/c21-19(17-9-10-18(25-17)20-22-11-12-23-20)14-5-4-8-16(13-14)24-15-6-2-1-3-7-15/h1-10,13,20H,11-12H2
SMILES:c1ccc(cc1)Oc1cccc(c1)C(=O)c1ccc(C2OCCO2)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.