CymitQuimica logo

CAS 898778-27-3

:

1-(2-fluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one

Description:
1-(2-Fluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-27-3, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features two aromatic rings: one containing a fluorine atom at the para position and the other containing three fluorine atoms at the meta and para positions. The presence of multiple fluorine substituents enhances the compound's lipophilicity and may influence its reactivity and biological activity. Typically, such fluorinated compounds exhibit unique properties, including increased stability and altered electronic characteristics, which can be advantageous in pharmaceutical applications. The compound's molecular structure suggests potential uses in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for confirmation of structure and purity. Overall, this compound exemplifies the significance of fluorinated organic molecules in various chemical and industrial applications.
Formula:C15H10F4O
InChI:InChI=1/C15H10F4O/c16-11-4-2-1-3-10(11)14(20)6-5-9-7-12(17)15(19)13(18)8-9/h1-4,7-8H,5-6H2
SMILES:c1ccc(c(c1)C(=O)CCc1cc(c(c(c1)F)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.