CAS 898778-30-8
:1-[2-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-[2-(Trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one, with CAS number 898778-30-8, is a synthetic organic compound characterized by its complex structure featuring multiple fluorinated aromatic rings. This compound typically exhibits high lipophilicity due to the presence of trifluoromethyl groups, which can enhance its biological activity and stability. The trifluoromethyl groups contribute to its unique electronic properties, potentially affecting its reactivity and interaction with biological targets. As a ketone, it contains a carbonyl functional group, which can participate in various chemical reactions, including nucleophilic additions. The presence of multiple fluorine atoms often results in increased volatility and altered solubility compared to non-fluorinated analogs. This compound may be of interest in pharmaceutical research and development, particularly in the design of novel therapeutic agents, due to its potential biological activity and the influence of fluorine on pharmacokinetics. However, specific applications and safety profiles would require further investigation and analysis.
Formula:C16H10F6O
InChI:InChI=1/C16H10F6O/c17-12-7-9(8-13(18)15(12)19)5-6-14(23)10-3-1-2-4-11(10)16(20,21)22/h1-4,7-8H,5-6H2
SMILES:c1ccc(c(c1)C(=O)CCc1cc(c(c(c1)F)F)F)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.