CAS 898778-33-1
:1-[3-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-[3-(Trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)propan-1-one, identified by its CAS number 898778-33-1, is an organic compound characterized by its complex structure featuring multiple fluorinated aromatic rings. This compound typically exhibits a high degree of lipophilicity due to the presence of trifluoromethyl groups, which can enhance its biological activity and influence its interactions with other molecules. The trifluoromethyl groups contribute to its unique electronic properties, potentially affecting its reactivity and stability. As a ketone, it contains a carbonyl functional group, which is known for its role in various chemical reactions, including nucleophilic additions. The presence of multiple fluorine atoms can also impart significant thermal and chemical stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, its unique characteristics stem from the combination of its fluorinated substituents and the ketone functional group.
Formula:C16H10F6O
InChI:InChI=1/C16H10F6O/c17-12-6-9(7-13(18)15(12)19)4-5-14(23)10-2-1-3-11(8-10)16(20,21)22/h1-3,6-8H,4-5H2
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)CCc1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.