CAS 898778-36-4

1-Propanone, 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)-, also known by its CAS number 898778-36-4, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone substituted with two distinct aromatic rings, each containing trifluoromethyl groups, which significantly influence its chemical properties. The presence of these trifluoromethyl groups enhances the compound's lipophilicity and may contribute to its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit a relatively high boiling point and low volatility due to the presence of multiple fluorine atoms, which also impart unique reactivity patterns. Additionally, the trifluoromethyl groups can enhance the compound's stability and resistance to oxidation. As with many fluorinated compounds, it may exhibit specific interactions with biological systems, warranting further investigation into its potential applications and environmental impact. Safety data should be reviewed to ensure proper handling and usage in laboratory or industrial settings.

Formula: C₁₆H₁₀F₆O

InChI: InChI=1S/C16H10F6O/c17-12-7-9(8-13(18)15(12)19)1-6-14(23)10-2-4-11(5-3-10)16(20,21)22/h2-5,7-8H,1,6H2

InChI key: InChIKey=ULDHWBLQGOZMDK-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=C(F)C(F)=C1)(=O)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 4′-Trifluoromethyl-3-(3,4,5-trifluorophenyl)-propiophenone
• 1-Propanone, 1-[4-(trifluoromethyl)phenyl]-3-(3,4,5-trifluorophenyl)-

4′-trifluoromethyl-3-(3,4,5-trifluorophenyl)propiophenone

CAS: 898778-36-4

Formula: C₁₆H₁₀F₆O

Purity: 97.0%

Molecular weight: 332.245

Ref: 10-F206773