CAS 898778-38-6
:ethyl 6-(4-isopropylphenyl)-6-oxo-hexanoate
Description:
Ethyl 6-(4-isopropylphenyl)-6-oxo-hexanoate, identified by its CAS number 898778-38-6, is an organic compound characterized by its ester functional group, which is typical of ethyl esters. This compound features a hexanoate backbone, indicating a six-carbon chain with a ketone (oxo) group at the sixth position, contributing to its reactivity and potential applications in organic synthesis. The presence of a 4-isopropylphenyl substituent introduces aromatic characteristics, enhancing its hydrophobic properties and influencing its solubility in organic solvents. The molecular structure suggests potential uses in pharmaceuticals or as an intermediate in the synthesis of more complex organic molecules. Additionally, the compound's unique arrangement of functional groups may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Overall, ethyl 6-(4-isopropylphenyl)-6-oxo-hexanoate exemplifies the diversity of organic compounds and their potential utility in various chemical applications.
Formula:C17H24O3
InChI:InChI=1/C17H24O3/c1-4-20-17(19)8-6-5-7-16(18)15-11-9-14(10-12-15)13(2)3/h9-13H,4-8H2,1-3H3
SMILES:CCOC(=O)CCCCC(=O)c1ccc(cc1)C(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.