CAS 898778-39-7
:1-(4-bromo-2-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(4-bromo-2-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, identified by its CAS number 898778-39-7, is an organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a propanone functional group, which is indicative of ketones, and is further substituted with a bromo and a fluoro group on the phenyl rings. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its reactivity and biological activity. The compound is likely to exhibit significant polar characteristics due to the electronegative halogens, which can affect its solubility in various solvents. Additionally, the presence of multiple fluorine atoms can impart unique properties such as increased stability and altered electronic characteristics. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in pharmaceuticals and agrochemicals. However, specific safety and handling guidelines should be followed due to the presence of halogens, which can pose health and environmental risks.
Formula:C15H9BrF4O
InChI:InChI=1/C15H9BrF4O/c16-9-2-3-10(11(17)7-9)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2
SMILES:C(CC(=O)c1ccc(cc1F)Br)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.