CAS 898778-40-0
:[5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(1-methylethoxy)phenyl]methanone
Description:
The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(1-methylethoxy)phenyl]methanone, with the CAS number 898778-40-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a thienyl group, a dioxolane ring, and a methanone moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. Its structure suggests that it may possess interesting electronic and optical properties, making it a candidate for applications in organic electronics or as a potential pharmaceutical intermediate. The presence of functional groups like the dioxolane and thienyl rings may also impart specific reactivity patterns, influencing its behavior in chemical reactions. Additionally, the compound's unique arrangement of substituents could lead to distinctive biological activities, warranting further investigation in medicinal chemistry. Overall, this compound exemplifies the diversity of synthetic organic chemistry and its potential applications in various fields.
Formula:C17H18O4S
InChI:InChI=1S/C17H18O4S/c1-11(2)21-13-5-3-12(4-6-13)16(18)14-7-8-15(22-14)17-19-9-10-20-17/h3-8,11,17H,9-10H2,1-2H3
InChI key:InChIKey=DRFICMRINCDJCM-UHFFFAOYSA-N
SMILES:C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(OC(C)C)C=C3
Synonyms:- Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl][4-(1-methylethoxy)phenyl]-
- [5-(1,3-Dioxolan-2-yl)-2-thienyl][4-(1-methylethoxy)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.