CAS 898778-41-1
:ethyl 8-(4-isopropylphenyl)-8-oxo-octanoate
Description:
Ethyl 8-(4-isopropylphenyl)-8-oxo-octanoate, with the CAS number 898778-41-1, is an organic compound characterized by its ester functional group and a complex structure that includes a long carbon chain and a ketone group. This compound features an ethyl ester moiety, which contributes to its solubility in organic solvents and potential applications in various chemical reactions. The presence of the 4-isopropylphenyl group indicates that it has aromatic characteristics, which can influence its reactivity and stability. The octanoate chain suggests that it may exhibit hydrophobic properties, making it less soluble in water. Ethyl 8-(4-isopropylphenyl)-8-oxo-octanoate may be of interest in fields such as pharmaceuticals, agrochemicals, or materials science due to its unique structural features. Its synthesis and applications would typically involve organic synthesis techniques, and its behavior in chemical reactions would be influenced by the functional groups present in its structure. As with any chemical substance, safety data and handling precautions should be reviewed before use.
Formula:C19H28O3
InChI:InChI=1/C19H28O3/c1-4-22-19(21)10-8-6-5-7-9-18(20)17-13-11-16(12-14-17)15(2)3/h11-15H,4-10H2,1-3H3
SMILES:CCOC(=O)CCCCCCC(=O)c1ccc(cc1)C(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.