CymitQuimica logo

CAS 898778-45-5

:

1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3,4,5-trifluorophenyl)-

Description:
1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3,4,5-trifluorophenyl)-, with CAS number 898778-45-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with two distinct aromatic rings: one containing a chlorine and a fluorine atom, and the other bearing three fluorine atoms. The presence of these halogen substituents significantly influences the compound's chemical properties, including its reactivity, polarity, and potential biological activity. Typically, such compounds exhibit low to moderate solubility in water due to their hydrophobic aromatic rings, while being more soluble in organic solvents. The fluorine atoms can enhance the compound's lipophilicity and stability, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the specific arrangement of substituents can affect the compound's electronic properties, potentially impacting its interactions in biological systems or its utility in synthetic applications.
Formula:C15H9ClF4O
InChI:InChI=1S/C15H9ClF4O/c16-10-5-9(6-11(17)7-10)14(21)2-1-8-3-12(18)15(20)13(19)4-8/h3-7H,1-2H2
InChI key:InChIKey=FWFAIDNCYQPOLM-UHFFFAOYSA-N
SMILES:C(CCC1=CC(F)=C(F)C(F)=C1)(=O)C2=CC(Cl)=CC(F)=C2
Synonyms:
  • 1-(3-Chloro-5-fluorophenyl)-3-(3,4,5-trifluorophenyl)-1-propanone
  • 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3,4,5-trifluorophenyl)-
  • 3′-Chloro-5′-fluoro-3-(3,4,5-trifluorophenyl)-propiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.