CAS 898778-46-6

[5-(1,3-Dioxolan-2-yl)-2-thienyl](4-ethylphenyl)methanone

Description:

The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-ethylphenyl)methanone, with the CAS number 898778-46-6, is an organic compound characterized by its complex structure that includes a thienyl group, a dioxolane ring, and an ethylphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and solubility. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, including nucleophilic attacks and ring-opening reactions. Additionally, the thienyl group can contribute to the compound's electronic properties, potentially making it useful in applications such as organic electronics or as a precursor in synthetic chemistry. The ethylphenyl group may enhance the lipophilicity of the molecule, affecting its biological activity and interaction with other substances. Overall, this compound's unique structural features may lend it interesting properties for research and potential applications in pharmaceuticals or materials science.

Formula: C₁₆H₁₆O₃S

InChI: InChI=1/C16H16O3S/c1-2-11-3-5-12(6-4-11)15(17)13-7-8-14(20-13)16-18-9-10-19-16/h3-8,16H,2,9-10H2,1H3

InChI key: InChIKey=KFTSYCMSPCYPFV-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(CC)C=C3

Synonyms:

• Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl](4-ethylphenyl)-
• [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-ethylphenyl)methanone