CAS 898778-48-8
:1-(4-chloro-2-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(4-chloro-2-fluoro-phenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-48-8, is a synthetic organic compound characterized by its complex fluorinated aromatic structure. This compound features a propanone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The chlorinated and fluorinated phenyl groups can impart unique electronic properties, potentially affecting the compound's interaction with biological targets or its behavior in various chemical environments. Additionally, the compound's molecular structure suggests it may exhibit interesting physical properties, such as altered melting and boiling points compared to non-fluorinated analogs. Overall, this compound's distinctive characteristics make it a subject of interest for further research in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H9ClF4O
InChI:InChI=1/C15H9ClF4O/c16-9-2-3-10(11(17)7-9)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2
SMILES:C(CC(=O)c1ccc(cc1F)Cl)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.