CAS 898778-49-9

[5-(1,3-Dioxolan-2-yl)-2-thienyl](4-propylphenyl)methanone

Description:

The chemical substance known as [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-propylphenyl)methanone, with the CAS number 898778-49-9, is a synthetic organic compound characterized by its unique structural features. It contains a thienyl group, which is a five-membered aromatic ring containing sulfur, and a dioxolane moiety, which is a cyclic ether with two oxygen atoms in the ring. The presence of a propylphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity. This compound may exhibit interesting biological activities due to its complex structure, making it a candidate for various applications in medicinal chemistry and material science. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of functional groups such as the carbonyl (ketone) and ether may contribute to its chemical reactivity and stability under different conditions. Overall, this compound represents a fascinating example of how structural diversity in organic chemistry can lead to varied properties and potential applications.

Formula: C₁₇H₁₈O₃S

InChI: InChI=1S/C17H18O3S/c1-2-3-12-4-6-13(7-5-12)16(18)14-8-9-15(21-14)17-19-10-11-20-17/h4-9,17H,2-3,10-11H2,1H3

InChI key: InChIKey=OJIAKNAYNACWJZ-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(CCC)C=C3

Synonyms:

• Methanone, [5-(1,3-dioxolan-2-yl)-2-thienyl](4-propylphenyl)-
• [5-(1,3-Dioxolan-2-yl)-2-thienyl](4-propylphenyl)methanone