CAS 898778-51-3
:1-(2,3-dichlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(2,3-Dichlorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-51-3, is an organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a propanone backbone, which is a ketone functional group, and is substituted with a dichlorophenyl group and a trifluorophenyl group. The presence of chlorine and fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The dichlorophenyl moiety may enhance the compound's reactivity and stability, while the trifluorophenyl group can influence its electronic properties and interactions with biological targets. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of atoms and the presence of functional groups, which can significantly affect its behavior in various chemical environments.
Formula:C15H9Cl2F3O
InChI:InChI=1/C15H9Cl2F3O/c16-10-3-1-2-9(14(10)17)13(21)5-4-8-6-11(18)15(20)12(19)7-8/h1-3,6-7H,4-5H2
SMILES:c1cc(C(=O)CCc2cc(c(c(c2)F)F)F)c(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.