CAS 898778-52-4

(4-Butylphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone

Description:

The chemical substance known as (4-Butylphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone, with the CAS number 898778-52-4, is a synthetic organic compound characterized by its complex structure, which includes a butylphenyl group, a dioxolane ring, and a thienyl moiety. This compound typically exhibits properties associated with organic ketones, including potential applications in organic synthesis and materials science. Its molecular structure suggests it may possess interesting electronic and photophysical properties, making it a candidate for use in organic light-emitting diodes (OLEDs) or as a dye in various applications. The presence of the dioxolane ring may also impart specific reactivity or stability characteristics, influencing its behavior in chemical reactions. Additionally, the butyl group can enhance solubility in organic solvents, which is beneficial for processing and application in various formulations. Overall, this compound's unique structural features contribute to its potential utility in advanced chemical applications.

Formula: C₁₈H₂₀O₃S

InChI: InChI=1S/C18H20O3S/c1-2-3-4-13-5-7-14(8-6-13)17(19)15-9-10-16(22-15)18-20-11-12-21-18/h5-10,18H,2-4,11-12H2,1H3

InChI key: InChIKey=YFNGYJXDWSOXJK-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=CC1)C2OCCO2)C3=CC=C(CCCC)C=C3

Synonyms:

• (4-Butylphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]methanone
• Methanone, (4-butylphenyl)[5-(1,3-dioxolan-2-yl)-2-thienyl]-