CAS 898778-54-6

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,4,5-trifluorophenyl)-, also known by its CAS number 898778-54-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a trifluorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound is likely to be a solid or liquid at room temperature, depending on its molecular structure and intermolecular interactions. It may exhibit moderate to high stability under standard conditions but could be sensitive to light or heat. Additionally, due to the presence of halogen atoms, it may have specific reactivity patterns, making it of interest in various chemical syntheses or pharmaceutical applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₅H₉Cl₂F₃O

InChI: InChI=1S/C15H9Cl2F3O/c16-9-2-3-10(11(17)7-9)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2

InChI key: InChIKey=KVHCULWRITVPTO-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=C(Cl)C=C1)C2=CC(F)=C(F)C(F)=C2

Synonyms:

• 2′,4′-Dichloro-3-(3,4,5-trifluorophenyl)-propiophenone
• 1-(2,4-Dichlorophenyl)-3-(3,4,5-trifluorophenyl)-1-propanone
• 1-Propanone, 1-(2,4-dichlorophenyl)-3-(3,4,5-trifluorophenyl)-