CAS 898778-57-9
:[5-(1,3-dioxolan-2-yl)-2-thienyl]-(4-hexylphenyl)methanone
Description:
The chemical substance known as [5-(1,3-dioxolan-2-yl)-2-thienyl]-(4-hexylphenyl)methanone, with the CAS number 898778-57-9, is a synthetic organic compound characterized by its complex structure that includes a thienyl group, a dioxolane moiety, and a hexylphenyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the dioxolane ring suggests potential for participation in various chemical reactions, including nucleophilic attacks or cycloadditions. Additionally, the hexylphenyl group may enhance the lipophilicity of the molecule, potentially affecting its biological activity and interaction with lipid membranes. Such compounds are often studied for their applications in organic electronics, photochemistry, or as intermediates in the synthesis of more complex molecules. Overall, the unique combination of functional groups in this compound contributes to its potential utility in various chemical and material science applications.
Formula:C20H24O3S
InChI:InChI=1/C20H24O3S/c1-2-3-4-5-6-15-7-9-16(10-8-15)19(21)17-11-12-18(24-17)20-22-13-14-23-20/h7-12,20H,2-6,13-14H2,1H3
SMILES:CCCCCCc1ccc(cc1)C(=O)c1ccc(C2OCCO2)s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.