CAS 898778-64-8
:1-(3,4-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one
Description:
1-(3,4-Difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898778-64-8, is an organic compound characterized by its complex fluorinated aromatic structure. This compound features a propanone backbone, which is a ketone functional group, indicating the presence of a carbonyl group (C=O) flanked by two aromatic rings. The presence of multiple fluorine substituents on the phenyl rings enhances its lipophilicity and may influence its reactivity and biological activity. The fluorine atoms can also affect the compound's electronic properties, potentially making it a candidate for various applications in medicinal chemistry or materials science. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which may be of interest in drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electron-withdrawing nature of the fluorine substituents. Overall, this compound exemplifies the significance of fluorinated compounds in enhancing the properties of organic molecules.
Formula:C15H9F5O
InChI:InChI=1/C15H9F5O/c16-10-3-2-9(7-11(10)17)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2
SMILES:C(CC(=O)c1ccc(c(c1)F)F)c1cc(c(c(c1)F)F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.